C16H20Cl2N2Pt — CID 14577055
2-benzyl-3-phenylpropane-1,2-diamine;dichloroplatinum (PubChem CID 14577055) has the molecular formula C16H20Cl2N2Pt and a molecular weight of 506.33 g/mol. Its IUPAC name is 2-benzyl-3-phenylpropane-1,2-diamine;dichloroplatinum.
| Compound Name | 2-benzyl-3-phenylpropane-1,2-diamine;dichloroplatinum |
|---|---|
| PubChem CID | 14577055 |
| Molecular Formula | C16H20Cl2N2Pt |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-benzyl-3-phenylpropane-1,2-diamine;dichloroplatinum |
| SMILES | Cl[Pt]Cl.NCC(N)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2.2ClH.Pt/c17-13-16(18,11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15;;;/h1-10H,11-13,17-18H2;2*1H;/q;;;+2/p-2 |
| InChIKey | OMABFMBLZCRJEG-UHFFFAOYSA-L |
| XLogP | 3.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |