About [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone
[4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone (PubChem CID 14577410) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone |
| PubChem CID | 14577410 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone |
| SMILES | COc1ccc(OC)c2c1CCN(CC1CCN(C(=O)c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C24H30N2O3/c1-28-22-8-9-23(29-2)21-17-25(13-12-20(21)22)16-18-10-14-26(15-11-18)24(27)19-6-4-3-5-7-19/h3-9,18H,10-17H2,1-2H3 |
| InChIKey | GIPUTWVYOUGUFO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone?
The IUPAC name of [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone (CID 14577410) is [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone?
The canonical SMILES for [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone is COc1ccc(OC)c2c1CCN(CC1CCN(C(=O)c3ccccc3)CC1)C2.
What is the InChIKey of [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone?
The InChIKey is GIPUTWVYOUGUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-28-22-8-9-23(29-2)21-17-25(13-12-20(21)22)16-18-10-14-26(15-11-18)24(27)19-6-4-3-5-7-19/h3-9,18H,10-17H2,1-2H3.
What are the key properties of [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone?
[4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone has a molecular weight of 394.52 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]piperidin-1-yl]-phenylmethanone is sourced from PubChem (CID 14577410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).