About [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone
[4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone (PubChem CID 14577473) has the molecular formula C22H26N2O
and a molecular weight of 334.46 g/mol. Its IUPAC name is [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone.
Molecular Properties
| Compound Name | [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone |
| PubChem CID | 14577473 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCC(CN3Cc4ccccc4C3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O/c1-17-5-4-8-19(13-17)22(25)24-11-9-18(10-12-24)14-23-15-20-6-2-3-7-21(20)16-23/h2-8,13,18H,9-12,14-16H2,1H3 |
| InChIKey | ATLCQRWRYUTLHE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone?
The IUPAC name of [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone (CID 14577473) is [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone.
What is the SMILES notation for [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone?
The canonical SMILES for [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone is Cc1cccc(C(=O)N2CCC(CN3Cc4ccccc4C3)CC2)c1.
What is the InChIKey of [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone?
The InChIKey is ATLCQRWRYUTLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O/c1-17-5-4-8-19(13-17)22(25)24-11-9-18(10-12-24)14-23-15-20-6-2-3-7-21(20)16-23/h2-8,13,18H,9-12,14-16H2,1H3.
What are the key properties of [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone?
[4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone has a molecular weight of 334.46 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dihydroisoindol-2-ylmethyl)piperidin-1-yl]-(3-methylphenyl)methanone is sourced from PubChem (CID 14577473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).