About [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea
[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea (PubChem CID 14578079) has the molecular formula C5H4F3N3O2
and a molecular weight of 195.10 g/mol. Its IUPAC name is [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea.
Molecular Properties
| Compound Name | [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
| PubChem CID | 14578079 |
| Molecular Formula | C5H4F3N3O2 |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
| SMILES | NC(=O)Nc1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C5H4F3N3O2/c6-5(7,8)2-1-3(13-11-2)10-4(9)12/h1H,(H3,9,10,12) |
| InChIKey | FDHGSOKUPDOLKR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea?
The IUPAC name of [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea (CID 14578079) is [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea.
What is the SMILES notation for [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea?
The canonical SMILES for [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea is NC(=O)Nc1cc(C(F)(F)F)no1.
What is the InChIKey of [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea?
The InChIKey is FDHGSOKUPDOLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F3N3O2/c6-5(7,8)2-1-3(13-11-2)10-4(9)12/h1H,(H3,9,10,12).
What are the key properties of [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea?
[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea has a molecular weight of 195.10 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(trifluoromethyl)-1,2-oxazol-5-yl]urea is sourced from PubChem (CID 14578079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).