C23H31N3O3S — CID 14578630
2-[(5,6-diethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]-4-methoxy-N,N,3,5-tetramethylaniline (PubChem CID 14578630) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[(5,6-diethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]-4-methoxy-N,N,3,5-tetramethylaniline.
| Compound Name | 2-[(5,6-diethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]-4-methoxy-N,N,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 14578630 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[(5,6-diethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]-4-methoxy-N,N,3,5-tetramethylaniline |
| SMILES | CCOc1cc2nc(SCc3c(N(C)C)cc(C)c(OC)c3C)[nH]c2cc1OCC |
| InChI | InChI=1S/C23H31N3O3S/c1-8-28-20-11-17-18(12-21(20)29-9-2)25-23(24-17)30-13-16-15(4)22(27-7)14(3)10-19(16)26(5)6/h10-12H,8-9,13H2,1-7H3,(H,24,25) |
| InChIKey | LCMZNDAQUMVKDR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|