C32H56O3Si2 — CID 14578731
(2E)-2-[(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol (PubChem CID 14578731) has the molecular formula C32H56O3Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is (2E)-2-[(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol.
| Compound Name | (2E)-2-[(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
|---|---|
| PubChem CID | 14578731 |
| Molecular Formula | C32H56O3Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | (2E)-2-[(3aS,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
| SMILES | CCC#CC[C@H](C)[C@@H](C#C[C@@H]1[C@H]2C/C(=C/CO)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56O3Si2/c1-13-14-15-16-24(2)29(34-36(9,10)31(3,4)5)18-17-27-28-22-25(19-20-33)21-26(28)23-30(27)35-37(11,12)32(6,7)8/h19,24,26-30,33H,13,16,20-23H2,1-12H3/b25-19+/t24-,26-,27+,28-,29+,30+/m0/s1 |
| InChIKey | JUFPLPDNHQXFDG-RTHVTEDFSA-N |
| XLogP | 8.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|