2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid

C15H14F3NO3 — CID 14578784

IUPAC2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid
SMILESCCC=C=CC(NC(=O)c1ccccc1)(C(=O)O)C(F)(F)F
InChIInChI=1S/C15H14F3NO3/c1-2-3-7-10-14(13(21)22,15(16,17)18)19-12(20)11-8-5-4-6-9-11/h3-6,8-10H,2H2,1H3,(H,19,20)(H,21,22)
InChIKeyBFIDWIYJVINZOX-UHFFFAOYSA-N
MW313.28 g/mol
LogP2.92
Rot. Bonds5

About 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid

2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid (PubChem CID 14578784) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid.

Molecular Properties

Compound Name2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid
PubChem CID14578784
Molecular FormulaC15H14F3NO3
Molecular Weight313.28 g/mol
Exact Mass313.09
IUPAC Name2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid
SMILESCCC=C=CC(NC(=O)c1ccccc1)(C(=O)O)C(F)(F)F
InChIInChI=1S/C15H14F3NO3/c1-2-3-7-10-14(13(21)22,15(16,17)18)19-12(20)11-8-5-4-6-9-11/h3-6,8-10H,2H2,1H3,(H,19,20)(H,21,22)
InChIKeyBFIDWIYJVINZOX-UHFFFAOYSA-N
XLogP2.92
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.28
LogP ≤ 52.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid?
The IUPAC name of 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid (CID 14578784) is 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid.
What is the SMILES notation for 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid?
The canonical SMILES for 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid is CCC=C=CC(NC(=O)c1ccccc1)(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid?
The InChIKey is BFIDWIYJVINZOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3NO3/c1-2-3-7-10-14(13(21)22,15(16,17)18)19-12(20)11-8-5-4-6-9-11/h3-6,8-10H,2H2,1H3,(H,19,20)(H,21,22).
What are the key properties of 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid?
2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid has a molecular weight of 313.28 g/mol, XLogP of 2.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-2-(trifluoromethyl)hepta-3,4-dienoic acid is sourced from PubChem (CID 14578784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).