About 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene
1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene (PubChem CID 14579002) has the molecular formula C16H14OS
and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene.
Molecular Properties
| Compound Name | 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene |
| PubChem CID | 14579002 |
| Molecular Formula | C16H14OS |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene |
| SMILES | C#CCC#CCC#CCOc1ccc(SC)cc1 |
| InChI | InChI=1S/C16H14OS/c1-3-4-5-6-7-8-9-14-17-15-10-12-16(18-2)13-11-15/h1,10-13H,4,7,14H2,2H3 |
| InChIKey | JPVWAEFSQCWVTA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene?
The IUPAC name of 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene (CID 14579002) is 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene.
What is the SMILES notation for 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene?
The canonical SMILES for 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene is C#CCC#CCC#CCOc1ccc(SC)cc1.
What is the InChIKey of 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene?
The InChIKey is JPVWAEFSQCWVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS/c1-3-4-5-6-7-8-9-14-17-15-10-12-16(18-2)13-11-15/h1,10-13H,4,7,14H2,2H3.
What are the key properties of 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene?
1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene has a molecular weight of 254.35 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanyl-4-nona-2,5,8-triynoxybenzene is sourced from PubChem (CID 14579002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).