About N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide
N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide (PubChem CID 1457965) has the molecular formula C19H23N3O4
and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide |
| PubChem CID | 1457965 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide |
| SMILES | COc1cc2nc(C3CCC3)n(NC(=O)C3CCC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C19H23N3O4/c1-25-15-9-13-14(10-16(15)26-2)20-17(11-5-3-6-11)22(19(13)24)21-18(23)12-7-4-8-12/h9-12H,3-8H2,1-2H3,(H,21,23) |
| InChIKey | DTCJGZUHCORMNG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide?
The IUPAC name of N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide (CID 1457965) is N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide.
What is the SMILES notation for N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide?
The canonical SMILES for N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide is COc1cc2nc(C3CCC3)n(NC(=O)C3CCC3)c(=O)c2cc1OC.
What is the InChIKey of N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide?
The InChIKey is DTCJGZUHCORMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O4/c1-25-15-9-13-14(10-16(15)26-2)20-17(11-5-3-6-11)22(19(13)24)21-18(23)12-7-4-8-12/h9-12H,3-8H2,1-2H3,(H,21,23).
What are the key properties of N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide?
N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide has a molecular weight of 357.41 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclobutyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)cyclobutanecarboxamide is sourced from PubChem (CID 1457965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).