About Triallyl-glucose
Triallyl-glucose (PubChem CID 145797543) has the molecular formula C15H24O6
and a molecular weight of 300.35 g/mol. Its IUPAC name is (5R,6S)-5,6-dihydroxy-5-prop-2-enyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]nona-1,8-dien-4-one.
Molecular Properties
| Compound Name | Triallyl-glucose |
| PubChem CID | 145797543 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (5R,6S)-5,6-dihydroxy-5-prop-2-enyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]nona-1,8-dien-4-one |
| SMILES | C=CCC(=O)[C@@](CC=C)([C@](CC=C)([C@@H]([C@@H](CO)O)O)O)O |
| InChI | InChI=1S/C15H24O6/c1-4-7-12(18)14(20,8-5-2)15(21,9-6-3)13(19)11(17)10-16/h4-6,11,13,16-17,19-21H,1-3,7-10H2/t11-,13-,14+,15+/m1/s1 |
| InChIKey | UGTLSNORSDMHKG-RZFFKMDDSA-N |
| XLogP | -0.60 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | 394 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Triallyl-glucose with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triallyl-glucose?
The IUPAC name of Triallyl-glucose (CID 145797543) is (5R,6S)-5,6-dihydroxy-5-prop-2-enyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]nona-1,8-dien-4-one.
What is the SMILES notation for Triallyl-glucose?
The canonical SMILES for Triallyl-glucose is C=CCC(=O)[C@@](CC=C)([C@](CC=C)([C@@H]([C@@H](CO)O)O)O)O.
What is the InChIKey of Triallyl-glucose?
The InChIKey is UGTLSNORSDMHKG-RZFFKMDDSA-N. The full InChI is InChI=1S/C15H24O6/c1-4-7-12(18)14(20,8-5-2)15(21,9-6-3)13(19)11(17)10-16/h4-6,11,13,16-17,19-21H,1-3,7-10H2/t11-,13-,14+,15+/m1/s1.
What are the key properties of Triallyl-glucose?
Triallyl-glucose has a molecular weight of 300.35 g/mol, XLogP of -0.60, 11 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Triallyl-glucose is sourced from PubChem (CID 145797543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).