C19H17ClFN3O2 — CID 14579927
4-but-3-yn-2-yl-6-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-7-fluoro-1,4-benzoxazin-3-one (PubChem CID 14579927) has the molecular formula C19H17ClFN3O2 and a molecular weight of 373.82 g/mol. Its IUPAC name is 4-but-3-yn-2-yl-6-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-7-fluoro-1,4-benzoxazin-3-one.
| Compound Name | 4-but-3-yn-2-yl-6-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-7-fluoro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 14579927 |
| Molecular Formula | C19H17ClFN3O2 |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-but-3-yn-2-yl-6-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-7-fluoro-1,4-benzoxazin-3-one |
| SMILES | C#CC(C)N1C(=O)COc2cc(F)c(-n3nc4c(c3Cl)CCCC4)cc21 |
| InChI | InChI=1S/C19H17ClFN3O2/c1-3-11(2)23-16-9-15(13(21)8-17(16)26-10-18(23)25)24-19(20)12-6-4-5-7-14(12)22-24/h1,8-9,11H,4-7,10H2,2H3 |
| InChIKey | JLOWFXFZKAWVFP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|