C24H26N2O2S — CID 14580033
3-[3-(4-phenylpiperidin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 14580033) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-[3-(4-phenylpiperidin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[3-(4-phenylpiperidin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 14580033 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-[3-(4-phenylpiperidin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O2S/c27-29(28)23-12-5-10-21-9-4-11-22(24(21)23)26(29)16-6-15-25-17-13-20(14-18-25)19-7-2-1-3-8-19/h1-5,7-12,20H,6,13-18H2 |
| InChIKey | IMZYYYXDGIFJFD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |