C23H22N2O2S — CID 14580042
3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 14580042) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 14580042 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H22N2O2S/c26-28(27)22-11-5-9-20-8-4-10-21(23(20)22)25(28)17-16-24-14-12-19(13-15-24)18-6-2-1-3-7-18/h1-12H,13-17H2 |
| InChIKey | GGWHOXVBCOIHCB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |