About 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene
1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene (PubChem CID 14580828) has the molecular formula C24H23F3O2S
and a molecular weight of 432.51 g/mol. Its IUPAC name is 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene.
Molecular Properties
| Compound Name | 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene |
| PubChem CID | 14580828 |
| Molecular Formula | C24H23F3O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene |
| SMILES | CCOc1ccc(C(COCc2cccc(Sc3ccccc3)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23F3O2S/c1-2-29-20-13-11-19(12-14-20)23(24(25,26)27)17-28-16-18-7-6-10-22(15-18)30-21-8-4-3-5-9-21/h3-15,23H,2,16-17H2,1H3 |
| InChIKey | VVKVYFAONQYHRI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene?
The IUPAC name of 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene (CID 14580828) is 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene.
What is the SMILES notation for 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene?
The canonical SMILES for 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene is CCOc1ccc(C(COCc2cccc(Sc3ccccc3)c2)C(F)(F)F)cc1.
What is the InChIKey of 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene?
The InChIKey is VVKVYFAONQYHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F3O2S/c1-2-29-20-13-11-19(12-14-20)23(24(25,26)27)17-28-16-18-7-6-10-22(15-18)30-21-8-4-3-5-9-21/h3-15,23H,2,16-17H2,1H3.
What are the key properties of 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene?
1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene has a molecular weight of 432.51 g/mol, XLogP of 7.10, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-[1,1,1-trifluoro-3-[(3-phenylsulfanylphenyl)methoxy]propan-2-yl]benzene is sourced from PubChem (CID 14580828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).