C27H28O5 — CID 14584361
(1R,3R,4R,5S,6R)-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptane (PubChem CID 14584361) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (1R,3R,4R,5S,6R)-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptane.
| Compound Name | (1R,3R,4R,5S,6R)-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 14584361 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (1R,3R,4R,5S,6R)-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptane |
| SMILES | c1ccc(COC[C@H]2O[C@@H]3O[C@H]2[C@H](OCc2ccccc2)[C@H]3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28O5/c1-4-10-20(11-5-1)16-28-19-23-24-25(29-17-21-12-6-2-7-13-21)26(27(31-23)32-24)30-18-22-14-8-3-9-15-22/h1-15,23-27H,16-19H2/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | XECSHKNUIYGKGY-IURCNINISA-N |
| XLogP | 4.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |