C26H38O5S — CID 14585166
[(8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-ethylsulfanylpropanoate (PubChem CID 14585166) has the molecular formula C26H38O5S and a molecular weight of 462.65 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-ethylsulfanylpropanoate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-ethylsulfanylpropanoate |
|---|---|
| PubChem CID | 14585166 |
| Molecular Formula | C26H38O5S |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,17R)-17-acetyl-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-ethylsulfanylpropanoate |
| SMILES | CCSCCC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H38O5S/c1-5-32-13-10-22(30)31-26(16(2)27)12-9-20-19-7-6-17-14-18(28)8-11-24(17,3)23(19)21(29)15-25(20,26)4/h14,19-21,23,29H,5-13,15H2,1-4H3/t19-,20-,21-,23+,24-,25-,26-/m0/s1 |
| InChIKey | GKIHAYRFPXGMGQ-VRRJBYJJSA-N |
| XLogP | 4.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|