C11H10N2OS2 — CID 14585498
2-methylsulfinyl-4,9-dihydro-[1,3]thiazino[6,5-b]indole (PubChem CID 14585498) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-methylsulfinyl-4,9-dihydro-[1,3]thiazino[6,5-b]indole.
| Compound Name | 2-methylsulfinyl-4,9-dihydro-[1,3]thiazino[6,5-b]indole |
|---|---|
| PubChem CID | 14585498 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-methylsulfinyl-4,9-dihydro-[1,3]thiazino[6,5-b]indole |
| SMILES | CS(=O)C1=NCc2c([nH]c3ccccc23)S1 |
| InChI | InChI=1S/C11H10N2OS2/c1-16(14)11-12-6-8-7-4-2-3-5-9(7)13-10(8)15-11/h2-5,13H,6H2,1H3 |
| InChIKey | YUXKTUVIOWXKPA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |