About methyl 2-(1,3-thiazol-2-ylamino)propanoate
methyl 2-(1,3-thiazol-2-ylamino)propanoate (PubChem CID 14585564) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is methyl 2-(1,3-thiazol-2-ylamino)propanoate.
Molecular Properties
| Compound Name | methyl 2-(1,3-thiazol-2-ylamino)propanoate |
| PubChem CID | 14585564 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl 2-(1,3-thiazol-2-ylamino)propanoate |
| SMILES | COC(=O)C(C)Nc1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5(6(10)11-2)9-7-8-3-4-12-7/h3-5H,1-2H3,(H,8,9) |
| InChIKey | QKYXPXOJJFKYAS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(1,3-thiazol-2-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,3-thiazol-2-ylamino)propanoate?
The IUPAC name of methyl 2-(1,3-thiazol-2-ylamino)propanoate (CID 14585564) is methyl 2-(1,3-thiazol-2-ylamino)propanoate.
What is the SMILES notation for methyl 2-(1,3-thiazol-2-ylamino)propanoate?
The canonical SMILES for methyl 2-(1,3-thiazol-2-ylamino)propanoate is COC(=O)C(C)Nc1nccs1.
What is the InChIKey of methyl 2-(1,3-thiazol-2-ylamino)propanoate?
The InChIKey is QKYXPXOJJFKYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-5(6(10)11-2)9-7-8-3-4-12-7/h3-5H,1-2H3,(H,8,9).
What are the key properties of methyl 2-(1,3-thiazol-2-ylamino)propanoate?
methyl 2-(1,3-thiazol-2-ylamino)propanoate has a molecular weight of 186.24 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-thiazol-2-ylamino)propanoate is sourced from PubChem (CID 14585564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).