C18H23F3N2O2S — CID 1458567
N-[(1R)-2-(cyclohexylamino)-1-(5-methylthiophen-2-yl)-2-oxoethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide (PubChem CID 1458567) has the molecular formula C18H23F3N2O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[(1R)-2-(cyclohexylamino)-1-(5-methylthiophen-2-yl)-2-oxoethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide.
| Compound Name | N-[(1R)-2-(cyclohexylamino)-1-(5-methylthiophen-2-yl)-2-oxoethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 1458567 |
| Molecular Formula | C18H23F3N2O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[(1R)-2-(cyclohexylamino)-1-(5-methylthiophen-2-yl)-2-oxoethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(F)(F)F)[C@H](C(=O)NC1CCCCC1)c1ccc(C)s1 |
| InChI | InChI=1S/C18H23F3N2O2S/c1-3-11-23(17(25)18(19,20)21)15(14-10-9-12(2)26-14)16(24)22-13-7-5-4-6-8-13/h3,9-10,13,15H,1,4-8,11H2,2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | SPVKCOOPTCXQPY-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|