About N,N'-bis(3-aminobutyl)octane-1,8-diamine
N,N'-bis(3-aminobutyl)octane-1,8-diamine (PubChem CID 14585911) has the molecular formula C16H38N4
and a molecular weight of 286.51 g/mol. Its IUPAC name is N,N'-bis(3-aminobutyl)octane-1,8-diamine.
Molecular Properties
| Compound Name | N,N'-bis(3-aminobutyl)octane-1,8-diamine |
| PubChem CID | 14585911 |
| Molecular Formula | C16H38N4 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.31 |
| IUPAC Name | N,N'-bis(3-aminobutyl)octane-1,8-diamine |
| SMILES | CC(N)CCNCCCCCCCCNCCC(C)N |
| InChI | InChI=1S/C16H38N4/c1-15(17)9-13-19-11-7-5-3-4-6-8-12-20-14-10-16(2)18/h15-16,19-20H,3-14,17-18H2,1-2H3 |
| InChIKey | VLYRLIMLXGWDID-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(3-aminobutyl)octane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(3-aminobutyl)octane-1,8-diamine?
The IUPAC name of N,N'-bis(3-aminobutyl)octane-1,8-diamine (CID 14585911) is N,N'-bis(3-aminobutyl)octane-1,8-diamine.
What is the SMILES notation for N,N'-bis(3-aminobutyl)octane-1,8-diamine?
The canonical SMILES for N,N'-bis(3-aminobutyl)octane-1,8-diamine is CC(N)CCNCCCCCCCCNCCC(C)N.
What is the InChIKey of N,N'-bis(3-aminobutyl)octane-1,8-diamine?
The InChIKey is VLYRLIMLXGWDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H38N4/c1-15(17)9-13-19-11-7-5-3-4-6-8-12-20-14-10-16(2)18/h15-16,19-20H,3-14,17-18H2,1-2H3.
What are the key properties of N,N'-bis(3-aminobutyl)octane-1,8-diamine?
N,N'-bis(3-aminobutyl)octane-1,8-diamine has a molecular weight of 286.51 g/mol, XLogP of 1.98, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-aminobutyl)octane-1,8-diamine is sourced from PubChem (CID 14585911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).