C17H21F3N2O2S — CID 1458693
N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide (PubChem CID 1458693) has the molecular formula C17H21F3N2O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide.
| Compound Name | N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 1458693 |
| Molecular Formula | C17H21F3N2O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(1R)-2-(cyclohexylamino)-2-oxo-1-thiophen-2-ylethyl]-2,2,2-trifluoro-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(F)(F)F)[C@H](C(=O)NC1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C17H21F3N2O2S/c1-2-10-22(16(24)17(18,19)20)14(13-9-6-11-25-13)15(23)21-12-7-4-3-5-8-12/h2,6,9,11-12,14H,1,3-5,7-8,10H2,(H,21,23)/t14-/m0/s1 |
| InChIKey | QDAFHSRKAPLKQG-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|