C20H26O4 — CID 14588306
methyl (1R,2R,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5-dimethyl-7-oxo-2,3,4,4a,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 14588306) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is methyl (1R,2R,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5-dimethyl-7-oxo-2,3,4,4a,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,2R,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5-dimethyl-7-oxo-2,3,4,4a,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 14588306 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl (1R,2R,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5-dimethyl-7-oxo-2,3,4,4a,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(CCc2ccoc2)[C@H](C)CC[C@@H]2C(C)=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C20H26O4/c1-13-10-16(21)11-18-17(13)5-4-14(2)20(18,19(22)23-3)8-6-15-7-9-24-12-15/h7,9-10,12,14,17-18H,4-6,8,11H2,1-3H3/t14-,17-,18+,20-/m1/s1 |
| InChIKey | YIQWACJXRWSNLU-XUMLPFHTSA-N |
| XLogP | 3.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |