C10H18O4 — CID 14588458
3-(1,3-dioxolan-2-ylmethyl)-4-methylpentanoic acid (PubChem CID 14588458) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-ylmethyl)-4-methylpentanoic acid.
| Compound Name | 3-(1,3-dioxolan-2-ylmethyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 14588458 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-(1,3-dioxolan-2-ylmethyl)-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)CC1OCCO1 |
| InChI | InChI=1S/C10H18O4/c1-7(2)8(5-9(11)12)6-10-13-3-4-14-10/h7-8,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | XUXDGMUTEDGMLM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |