C20H30O4 — CID 14588990
3-[(3E,7Z,11E)-13-hydroxy-8-(hydroxymethyl)-4,12-dimethyltrideca-3,7,11-trienyl]-2H-furan-5-one (PubChem CID 14588990) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-[(3E,7Z,11E)-13-hydroxy-8-(hydroxymethyl)-4,12-dimethyltrideca-3,7,11-trienyl]-2H-furan-5-one.
| Compound Name | 3-[(3E,7Z,11E)-13-hydroxy-8-(hydroxymethyl)-4,12-dimethyltrideca-3,7,11-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 14588990 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-[(3E,7Z,11E)-13-hydroxy-8-(hydroxymethyl)-4,12-dimethyltrideca-3,7,11-trienyl]-2H-furan-5-one |
| SMILES | C/C(=C\CC/C(=C/CC/C(C)=C/CCC1=CC(=O)OC1)CO)CO |
| InChI | InChI=1S/C20H30O4/c1-16(7-4-11-19-12-20(23)24-15-19)6-3-9-18(14-22)10-5-8-17(2)13-21/h7-9,12,21-22H,3-6,10-11,13-15H2,1-2H3/b16-7+,17-8+,18-9- |
| InChIKey | UVMQCFGEJNWYOG-XBZNVKMASA-N |
| XLogP | 3.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|