About N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide
N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (PubChem CID 14589595) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
Molecular Properties
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| PubChem CID | 14589595 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide |
| SMILES | CC(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C12H19NO/c1-7(14)13-12-6-8-5-11(12)10-4-2-3-9(8)10/h8-12H,2-6H2,1H3,(H,13,14) |
| InChIKey | JBSRXWWWDDOZPL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The IUPAC name of N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide (CID 14589595) is N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide.
What is the SMILES notation for N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The canonical SMILES for N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is CC(=O)NC1CC2CC1C1CCCC21.
What is the InChIKey of N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
The InChIKey is JBSRXWWWDDOZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-7(14)13-12-6-8-5-11(12)10-4-2-3-9(8)10/h8-12H,2-6H2,1H3,(H,13,14).
What are the key properties of N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide?
N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide has a molecular weight of 193.29 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-tricyclo[5.2.1.02,6]decanyl)acetamide is sourced from PubChem (CID 14589595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).