C10H17NO5 — CID 14590001
[(1S,6S,7R,8R,8aS)-6,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate (PubChem CID 14590001) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aS)-6,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate.
| Compound Name | [(1S,6S,7R,8R,8aS)-6,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
|---|---|
| PubChem CID | 14590001 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | [(1S,6S,7R,8R,8aS)-6,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN2C[C@H](O)[C@@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C10H17NO5/c1-5(12)16-7-2-3-11-4-6(13)9(14)10(15)8(7)11/h6-10,13-15H,2-4H2,1H3/t6-,7-,8+,9+,10+/m0/s1 |
| InChIKey | QDMOXCYSVFAWET-SRQGCSHVSA-N |
| XLogP | -1.91 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |