C20H27NO6 — CID 14590035
[(1S,6S,7R,8R,8aS)-6,8-dihydroxy-7-(2-phenylacetyl)oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] butanoate (PubChem CID 14590035) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aS)-6,8-dihydroxy-7-(2-phenylacetyl)oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] butanoate.
| Compound Name | [(1S,6S,7R,8R,8aS)-6,8-dihydroxy-7-(2-phenylacetyl)oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] butanoate |
|---|---|
| PubChem CID | 14590035 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [(1S,6S,7R,8R,8aS)-6,8-dihydroxy-7-(2-phenylacetyl)oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CCN2CC(O)[C@@H](OC(=O)Cc3ccccc3)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C20H27NO6/c1-2-6-16(23)26-15-9-10-21-12-14(22)20(19(25)18(15)21)27-17(24)11-13-7-4-3-5-8-13/h3-5,7-8,14-15,18-20,22,25H,2,6,9-12H2,1H3/t14?,15-,18+,19+,20+/m0/s1 |
| InChIKey | FNLOFZRPYJXCKW-XCDFPOGASA-N |
| XLogP | 0.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |