C16H24N4O2 — CID 14590523
propan-2-yl 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 14590523) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is propan-2-yl 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | propan-2-yl 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 14590523 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | propan-2-yl 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCCCCn1ncc2c(N)c(C(=O)OC(C)C)c(C)nc21 |
| InChI | InChI=1S/C16H24N4O2/c1-5-6-7-8-20-15-12(9-18-20)14(17)13(11(4)19-15)16(21)22-10(2)3/h9-10H,5-8H2,1-4H3,(H2,17,19) |
| InChIKey | YBWVWTQZZOFOIK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|