C12H28O2Si — CID 14590718
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentan-1-ol (PubChem CID 14590718) has the molecular formula C12H28O2Si and a molecular weight of 232.44 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentan-1-ol.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 14590718 |
| Molecular Formula | C12H28O2Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentan-1-ol |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO |
| InChI | InChI=1S/C12H28O2Si/c1-8-11(10(2)9-13)14-15(6,7)12(3,4)5/h10-11,13H,8-9H2,1-7H3/t10-,11-/m1/s1 |
| InChIKey | ZYDONJFMVJGOQA-GHMZBOCLSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|