C17H33NO6S — CID 14590834
[(3S,4S)-5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate (PubChem CID 14590834) has the molecular formula C17H33NO6S and a molecular weight of 379.52 g/mol. Its IUPAC name is [(3S,4S)-5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate.
| Compound Name | [(3S,4S)-5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate |
|---|---|
| PubChem CID | 14590834 |
| Molecular Formula | C17H33NO6S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [(3S,4S)-5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)[C@@H](O)CCOS(C)(=O)=O |
| InChI | InChI=1S/C17H33NO6S/c1-17(2,3)24-16(20)18-14(12-13-8-6-5-7-9-13)15(19)10-11-23-25(4,21)22/h13-15,19H,5-12H2,1-4H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | HJLVNWCXVBYMPJ-GJZGRUSLSA-N |
| XLogP | 2.58 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|