C3HF5N4 — CID 14591043
5-(1,1,2,2,2-pentafluoroethyl)-2H-tetrazole (PubChem CID 14591043) has the molecular formula C3HF5N4 and a molecular weight of 188.06 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-2H-tetrazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-2H-tetrazole |
|---|---|
| PubChem CID | 14591043 |
| Molecular Formula | C3HF5N4 |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-2H-tetrazole |
| SMILES | FC(F)(F)C(F)(F)c1nn[nH]n1 |
| InChI | InChI=1S/C3HF5N4/c4-2(5,3(6,7)8)1-9-11-12-10-1/h(H,9,10,11,12) |
| InChIKey | AQRFLATZASBDNT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|