About N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine
N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 14591211) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine |
| PubChem CID | 14591211 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine |
| SMILES | C=C1C=CC=CC1CN(C)C |
| InChI | InChI=1S/C10H15N/c1-9-6-4-5-7-10(9)8-11(2)3/h4-7,10H,1,8H2,2-3H3 |
| InChIKey | LZCAOIKWCBZDEB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine?
The IUPAC name of N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine (CID 14591211) is N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine.
What is the SMILES notation for N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine?
The canonical SMILES for N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine is C=C1C=CC=CC1CN(C)C.
What is the InChIKey of N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine?
The InChIKey is LZCAOIKWCBZDEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-9-6-4-5-7-10(9)8-11(2)3/h4-7,10H,1,8H2,2-3H3.
What are the key properties of N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine?
N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine has a molecular weight of 149.24 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(6-methylidenecyclohexa-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 14591211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).