C16H16N2 — CID 14591674
3,6-diphenyl-3,4,5,6-tetrahydropyridazine (PubChem CID 14591674) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3,6-diphenyl-3,4,5,6-tetrahydropyridazine.
| Compound Name | 3,6-diphenyl-3,4,5,6-tetrahydropyridazine |
|---|---|
| PubChem CID | 14591674 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3,6-diphenyl-3,4,5,6-tetrahydropyridazine |
| SMILES | c1ccc(C2CCC(c3ccccc3)N=N2)cc1 |
| InChI | InChI=1S/C16H16N2/c1-3-7-13(8-4-1)15-11-12-16(18-17-15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | URZYFAYWTNHYIF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |