C14H18O3 — CID 14592145
4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde (PubChem CID 14592145) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde.
| Compound Name | 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde |
|---|---|
| PubChem CID | 14592145 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde |
| SMILES | CCOC(/C=C/c1ccc(C=O)cc1)OCC |
| InChI | InChI=1S/C14H18O3/c1-3-16-14(17-4-2)10-9-12-5-7-13(11-15)8-6-12/h5-11,14H,3-4H2,1-2H3/b10-9+ |
| InChIKey | QXSUDSBYIULLPW-MDZDMXLPSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|