About 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde
4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde (PubChem CID 14592145) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde |
| PubChem CID | 14592145 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde |
| SMILES | CCOC(/C=C/c1ccc(C=O)cc1)OCC |
| InChI | InChI=1S/C14H18O3/c1-3-16-14(17-4-2)10-9-12-5-7-13(11-15)8-6-12/h5-11,14H,3-4H2,1-2H3/b10-9+ |
| InChIKey | QXSUDSBYIULLPW-MDZDMXLPSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde?
The IUPAC name of 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde (CID 14592145) is 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde.
What is the SMILES notation for 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde?
The canonical SMILES for 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde is CCOC(/C=C/c1ccc(C=O)cc1)OCC.
What is the InChIKey of 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde?
The InChIKey is QXSUDSBYIULLPW-MDZDMXLPSA-N. The full InChI is InChI=1S/C14H18O3/c1-3-16-14(17-4-2)10-9-12-5-7-13(11-15)8-6-12/h5-11,14H,3-4H2,1-2H3/b10-9+.
What are the key properties of 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde?
4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde has a molecular weight of 234.30 g/mol, XLogP of 2.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3,3-diethoxyprop-1-enyl]benzaldehyde is sourced from PubChem (CID 14592145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).