C29H30N2O4 — CID 1459246
N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-methoxy-N-[2-(2-methylphenyl)ethyl]benzamide (PubChem CID 1459246) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-methoxy-N-[2-(2-methylphenyl)ethyl]benzamide.
| Compound Name | N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-methoxy-N-[2-(2-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 1459246 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-methoxy-N-[2-(2-methylphenyl)ethyl]benzamide |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCc3ccccc3C)C(=O)c3ccccc3OC)cc2c1 |
| InChI | InChI=1S/C29H30N2O4/c1-4-35-24-13-14-26-22(18-24)17-23(28(32)30-26)19-31(16-15-21-10-6-5-9-20(21)2)29(33)25-11-7-8-12-27(25)34-3/h5-14,17-18H,4,15-16,19H2,1-3H3,(H,30,32) |
| InChIKey | UQPGWKTVZXGKKJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |