C15H20O3 — CID 14593196
2-hex-1-ynyl-3,4-dimethoxy-4-prop-2-enylcyclobut-2-en-1-one (PubChem CID 14593196) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-hex-1-ynyl-3,4-dimethoxy-4-prop-2-enylcyclobut-2-en-1-one.
| Compound Name | 2-hex-1-ynyl-3,4-dimethoxy-4-prop-2-enylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14593196 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-hex-1-ynyl-3,4-dimethoxy-4-prop-2-enylcyclobut-2-en-1-one |
| SMILES | C=CCC1(OC)C(=O)C(C#CCCCC)=C1OC |
| InChI | InChI=1S/C15H20O3/c1-5-7-8-9-10-12-13(16)15(18-4,11-6-2)14(12)17-3/h6H,2,5,7-8,11H2,1,3-4H3 |
| InChIKey | KWITVHGAZSHRPD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|