About N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine
N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine (PubChem CID 14593231) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine.
Molecular Properties
| Compound Name | N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine |
| PubChem CID | 14593231 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine |
| SMILES | C1#CC(=Nc2ccccc2)C#CCOCCCOC1 |
| InChI | InChI=1S/C16H15NO2/c1-2-7-15(8-3-1)17-16-9-4-11-18-13-6-14-19-12-5-10-16/h1-3,7-8H,6,11-14H2 |
| InChIKey | ZBCDLSWPFIZHOR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine?
The IUPAC name of N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine (CID 14593231) is N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine.
What is the SMILES notation for N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine?
The canonical SMILES for N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine is C1#CC(=Nc2ccccc2)C#CCOCCCOC1.
What is the InChIKey of N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine?
The InChIKey is ZBCDLSWPFIZHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c1-2-7-15(8-3-1)17-16-9-4-11-18-13-6-14-19-12-5-10-16/h1-3,7-8H,6,11-14H2.
What are the key properties of N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine?
N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine has a molecular weight of 253.30 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1,5-dioxacyclododeca-7,10-diyn-9-imine is sourced from PubChem (CID 14593231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).