About 2-nitrobutanoic acid
2-nitrobutanoic acid (PubChem CID 14593260) has the molecular formula C4H7NO4
and a molecular weight of 133.10 g/mol. Its IUPAC name is 2-nitrobutanoic acid.
Molecular Properties
| Compound Name | 2-nitrobutanoic acid |
| PubChem CID | 14593260 |
| Molecular Formula | C4H7NO4 |
| Molecular Weight | 133.10 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 2-nitrobutanoic acid |
| SMILES | CCC(C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C4H7NO4/c1-2-3(4(6)7)5(8)9/h3H,2H2,1H3,(H,6,7) |
| InChIKey | KSYBRTXOXKWUIR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.10 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobutanoic acid?
The IUPAC name of 2-nitrobutanoic acid (CID 14593260) is 2-nitrobutanoic acid.
What is the SMILES notation for 2-nitrobutanoic acid?
The canonical SMILES for 2-nitrobutanoic acid is CCC(C(=O)O)[N+](=O)[O-].
What is the InChIKey of 2-nitrobutanoic acid?
The InChIKey is KSYBRTXOXKWUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO4/c1-2-3(4(6)7)5(8)9/h3H,2H2,1H3,(H,6,7).
What are the key properties of 2-nitrobutanoic acid?
2-nitrobutanoic acid has a molecular weight of 133.10 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobutanoic acid is sourced from PubChem (CID 14593260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).