About 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane
2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane (PubChem CID 14593287) has the molecular formula C12H15FO4S
and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane.
Molecular Properties
| Compound Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane |
| PubChem CID | 14593287 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane |
| SMILES | O=S(=O)(c1ccccc1)C(F)CC1COCCO1 |
| InChI | InChI=1S/C12H15FO4S/c13-12(8-10-9-16-6-7-17-10)18(14,15)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2 |
| InChIKey | VORXTBZQMZAEJO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane?
The IUPAC name of 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane (CID 14593287) is 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane.
What is the SMILES notation for 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane?
The canonical SMILES for 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane is O=S(=O)(c1ccccc1)C(F)CC1COCCO1.
What is the InChIKey of 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane?
The InChIKey is VORXTBZQMZAEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO4S/c13-12(8-10-9-16-6-7-17-10)18(14,15)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2.
What are the key properties of 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane?
2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane has a molecular weight of 274.31 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,4-dioxane is sourced from PubChem (CID 14593287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).