C8ClF17 — CID 14594051
4-chloro-1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane (PubChem CID 14594051) has the molecular formula C8ClF17 and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-chloro-1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane.
| Compound Name | 4-chloro-1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
|---|---|
| PubChem CID | 14594051 |
| Molecular Formula | C8ClF17 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | 4-chloro-1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8ClF17/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 |
| InChIKey | LHGUNFULHKIGHX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|