About (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one
(3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one (PubChem CID 14594385) has the molecular formula C9H13ClO2
and a molecular weight of 188.65 g/mol. Its IUPAC name is (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one |
| PubChem CID | 14594385 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one |
| SMILES | CCC1/C(=C\Cl)C(=O)OC1(C)C |
| InChI | InChI=1S/C9H13ClO2/c1-4-7-6(5-10)8(11)12-9(7,2)3/h5,7H,4H2,1-3H3/b6-5+ |
| InChIKey | VRUUWDLSKRJNLH-AATRIKPKSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one?
The IUPAC name of (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one (CID 14594385) is (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one.
What is the SMILES notation for (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one?
The canonical SMILES for (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one is CCC1/C(=C\Cl)C(=O)OC1(C)C.
What is the InChIKey of (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one?
The InChIKey is VRUUWDLSKRJNLH-AATRIKPKSA-N. The full InChI is InChI=1S/C9H13ClO2/c1-4-7-6(5-10)8(11)12-9(7,2)3/h5,7H,4H2,1-3H3/b6-5+.
What are the key properties of (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one?
(3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one has a molecular weight of 188.65 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(chloromethylidene)-4-ethyl-5,5-dimethyloxolan-2-one is sourced from PubChem (CID 14594385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).