About 2-(chloromethyl)-3,3-diethoxyprop-1-ene
2-(chloromethyl)-3,3-diethoxyprop-1-ene (PubChem CID 14594993) has the molecular formula C8H15ClO2
and a molecular weight of 178.66 g/mol. Its IUPAC name is 2-(chloromethyl)-3,3-diethoxyprop-1-ene.
Molecular Properties
| Compound Name | 2-(chloromethyl)-3,3-diethoxyprop-1-ene |
| PubChem CID | 14594993 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-(chloromethyl)-3,3-diethoxyprop-1-ene |
| SMILES | C=C(CCl)C(OCC)OCC |
| InChI | InChI=1S/C8H15ClO2/c1-4-10-8(11-5-2)7(3)6-9/h8H,3-6H2,1-2H3 |
| InChIKey | JVQDWBSOLNZCGP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-3,3-diethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-3,3-diethoxyprop-1-ene?
The IUPAC name of 2-(chloromethyl)-3,3-diethoxyprop-1-ene (CID 14594993) is 2-(chloromethyl)-3,3-diethoxyprop-1-ene.
What is the SMILES notation for 2-(chloromethyl)-3,3-diethoxyprop-1-ene?
The canonical SMILES for 2-(chloromethyl)-3,3-diethoxyprop-1-ene is C=C(CCl)C(OCC)OCC.
What is the InChIKey of 2-(chloromethyl)-3,3-diethoxyprop-1-ene?
The InChIKey is JVQDWBSOLNZCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO2/c1-4-10-8(11-5-2)7(3)6-9/h8H,3-6H2,1-2H3.
What are the key properties of 2-(chloromethyl)-3,3-diethoxyprop-1-ene?
2-(chloromethyl)-3,3-diethoxyprop-1-ene has a molecular weight of 178.66 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-3,3-diethoxyprop-1-ene is sourced from PubChem (CID 14594993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).