C25H25ClFN3O2 — CID 145951804
2-[8-[(7-Chloroquinolin-4-yl)amino]octyl]-4-fluoroisoindole-1,3-dione (PubChem CID 145951804) has the molecular formula C25H25ClFN3O2 and a molecular weight of 453.90 g/mol. Its IUPAC name is 2-[8-[(7-chloroquinolin-4-yl)amino]octyl]-4-fluoroisoindole-1,3-dione.
| Compound Name | 2-[8-[(7-Chloroquinolin-4-yl)amino]octyl]-4-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 145951804 |
| Molecular Formula | C25H25ClFN3O2 |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[8-[(7-chloroquinolin-4-yl)amino]octyl]-4-fluoroisoindole-1,3-dione |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)N(C2=O)CCCCCCCCNC3=C4C=CC(=CC4=NC=C3)Cl |
| InChI | InChI=1S/C25H25ClFN3O2/c26-17-10-11-18-21(12-14-29-22(18)16-17)28-13-5-3-1-2-4-6-15-30-24(31)19-8-7-9-20(27)23(19)25(30)32/h7-12,14,16H,1-6,13,15H2,(H,28,29) |
| InChIKey | SUEGHCRUGJIPPY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | 651 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|