C19H31NS — CID 145954470
(1S,2R,3R,5R)-N-[(5-tert-butylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 145954470) has the molecular formula C19H31NS and a molecular weight of 305.50 g/mol. Its IUPAC name is (1S,2R,3R,5R)-N-[(5-tert-butylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1S,2R,3R,5R)-N-[(5-tert-butylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 145954470 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (1S,2R,3R,5R)-N-[(5-tert-butylthiophen-2-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@@H]1[C@@H]2C[C@@H](C2(C)C)C[C@H]1NCC3=CC=C(S3)C(C)(C)C |
| InChI | InChI=1S/C19H31NS/c1-12-15-9-13(19(15,5)6)10-16(12)20-11-14-7-8-17(21-14)18(2,3)4/h7-8,12-13,15-16,20H,9-11H2,1-6H3/t12-,13-,15+,16-/m1/s1 |
| InChIKey | QGDUEOKVEXICPO-LUYZLQTOSA-N |
| XLogP | 5.70 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 384 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |