C11H11ClN2 — CID 14595512
8-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 14595512) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 8-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 14595512 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | Clc1ccc2c(c1)cc1n2CCNC1 |
| InChI | InChI=1S/C11H11ClN2/c12-9-1-2-11-8(5-9)6-10-7-13-3-4-14(10)11/h1-2,5-6,13H,3-4,7H2 |
| InChIKey | QKGDOWUCRMVFPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |