fluoroboronic acid

H2BFO2 — CID 14595563

IUPACfluoroboronic acid
SMILESOB(O)F
InChIInChI=1S/BFH2O2/c2-1(3)4/h3-4H
InChIKeyVNWHJJCHHGPAEO-UHFFFAOYSA-N
MW63.82 g/mol
LogP-1.07
Rot. Bonds

About fluoroboronic acid

fluoroboronic acid (PubChem CID 14595563) has the molecular formula H2BFO2 and a molecular weight of 63.82 g/mol. Its IUPAC name is fluoroboronic acid.

Molecular Properties

Compound Namefluoroboronic acid
PubChem CID14595563
Molecular FormulaH2BFO2
Molecular Weight63.82 g/mol
Exact Mass64.01
IUPAC Namefluoroboronic acid
SMILESOB(O)F
InChIInChI=1S/BFH2O2/c2-1(3)4/h3-4H
InChIKeyVNWHJJCHHGPAEO-UHFFFAOYSA-N
XLogP-1.07
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50063.82
LogP ≤ 5-1.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze fluoroboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoroboronic acid?
The IUPAC name of fluoroboronic acid (CID 14595563) is fluoroboronic acid.
What is the SMILES notation for fluoroboronic acid?
The canonical SMILES for fluoroboronic acid is OB(O)F.
What is the InChIKey of fluoroboronic acid?
The InChIKey is VNWHJJCHHGPAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/BFH2O2/c2-1(3)4/h3-4H.
What are the key properties of fluoroboronic acid?
fluoroboronic acid has a molecular weight of 63.82 g/mol, XLogP of -1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroboronic acid is sourced from PubChem (CID 14595563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).