C7F15N — CID 14595605
2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)piperidine (PubChem CID 14595605) has the molecular formula C7F15N and a molecular weight of 383.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 14595605 |
| Molecular Formula | C7F15N |
| Molecular Weight | 383.05 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C7F15N/c8-1(4(13,14)15)2(9,10)3(11,12)6(18,19)23(5(1,16)17)7(20,21)22 |
| InChIKey | GUCBCVUEVNIHJG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|