C9H12F8O — CID 14595650
1,1,2,2,3,3,4,4-octafluoro-5-(2-methylpropoxy)pentane (PubChem CID 14595650) has the molecular formula C9H12F8O and a molecular weight of 288.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-5-(2-methylpropoxy)pentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-5-(2-methylpropoxy)pentane |
|---|---|
| PubChem CID | 14595650 |
| Molecular Formula | C9H12F8O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-5-(2-methylpropoxy)pentane |
| SMILES | CC(C)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H12F8O/c1-5(2)3-18-4-7(12,13)9(16,17)8(14,15)6(10)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | CWNYUSDMWVNMKX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|