About 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate
1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate (PubChem CID 14595814) has the molecular formula C12H16ClNO6
and a molecular weight of 305.71 g/mol. Its IUPAC name is 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate.
Molecular Properties
| Compound Name | 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate |
| PubChem CID | 14595814 |
| Molecular Formula | C12H16ClNO6 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate |
| SMILES | CC(=O)c1cc(C(C)=O)c(C)[n+](C)c1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C12H16NO2.ClHO4/c1-7-11(9(3)14)6-12(10(4)15)8(2)13(7)5;2-1(3,4)5/h6H,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NCWOVURLFISRQV-UHFFFAOYSA-M |
| XLogP | -3.22 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate?
The IUPAC name of 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate (CID 14595814) is 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate.
What is the SMILES notation for 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate?
The canonical SMILES for 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate is CC(=O)c1cc(C(C)=O)c(C)[n+](C)c1C.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate?
The InChIKey is NCWOVURLFISRQV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16NO2.ClHO4/c1-7-11(9(3)14)6-12(10(4)15)8(2)13(7)5;2-1(3,4)5/h6H,1-5H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate?
1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate has a molecular weight of 305.71 g/mol, XLogP of -3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-acetyl-1,2,6-trimethylpyridin-1-ium-3-yl)ethanone perchlorate is sourced from PubChem (CID 14595814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).