C20H28O7 — CID 145970294
[(1S,5R,6R)-3-(hydroxymethyl)-5-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-6-propan-2-ylcyclohex-3-en-1-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 145970294) has the molecular formula C20H28O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(1S,5R,6R)-3-(hydroxymethyl)-5-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-6-propan-2-ylcyclohex-3-en-1-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1S,5R,6R)-3-(hydroxymethyl)-5-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-6-propan-2-ylcyclohex-3-en-1-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 145970294 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(1S,5R,6R)-3-(hydroxymethyl)-5-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-6-propan-2-ylcyclohex-3-en-1-yl] (2R,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]1C=C(C(=O)[C@H]([C@@H]1C(C)C)OC(=O)[C@]2([C@H](O2)C)C)CO |
| InChI | InChI=1S/C20H28O7/c1-7-11(4)18(23)25-14-8-13(9-21)16(22)17(15(14)10(2)3)26-19(24)20(6)12(5)27-20/h7-8,10,12,14-15,17,21H,9H2,1-6H3/b11-7-/t12-,14-,15-,17+,20-/m1/s1 |
| InChIKey | ABWZXWZSTAKDDW-YSGBXONQSA-N |
| XLogP | 2.80 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | 690 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|